C23H50O4Si2 — CID 6426037
methyl 4,8,12-trimethyl-3,4-bis(trimethylsilyloxy)tridecanoate (PubChem CID 6426037) has the molecular formula C23H50O4Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is methyl 4,8,12-trimethyl-3,4-bis(trimethylsilyloxy)tridecanoate.
| Compound Name | methyl 4,8,12-trimethyl-3,4-bis(trimethylsilyloxy)tridecanoate |
|---|---|
| PubChem CID | 6426037 |
| Molecular Formula | C23H50O4Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | methyl 4,8,12-trimethyl-3,4-bis(trimethylsilyloxy)tridecanoate |
| SMILES | COC(=O)CC(O[Si](C)(C)C)C(C)(CCCC(C)CCCC(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H50O4Si2/c1-19(2)14-12-15-20(3)16-13-17-23(4,27-29(9,10)11)21(18-22(24)25-5)26-28(6,7)8/h19-21H,12-18H2,1-11H3 |
| InChIKey | AIZMBMUXCGYZSE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|