C34H70O5Si2 — CID 10348840
[(2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl] (2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoate (PubChem CID 10348840) has the molecular formula C34H70O5Si2 and a molecular weight of 615.10 g/mol. Its IUPAC name is [(2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl] (2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoate.
| Compound Name | [(2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl] (2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoate |
|---|---|
| PubChem CID | 10348840 |
| Molecular Formula | C34H70O5Si2 |
| Molecular Weight | 615.10 g/mol |
| Exact Mass | 614.48 |
| IUPAC Name | [(2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl] (2S,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoate |
| SMILES | CC[C@@H](C)C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)OC(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)CC |
| InChI | InChI=1S/C34H70O5Si2/c1-19-23(3)21-25(5)29(38-40(15,16)33(9,10)11)27(7)31(35)37-32(36)28(8)30(26(6)22-24(4)20-2)39-41(17,18)34(12,13)14/h23-30H,19-22H2,1-18H3/t23-,24-,25-,26-,27+,28+,29+,30+/m1/s1 |
| InChIKey | GNVVTPYNWWZEMV-TUWSUWLJSA-N |
| XLogP | 10.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.10 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|