C23H48O5Si2 — CID 50901909
(3R,4S)-4-[(2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-triethylsilyloxyhexan-2-yl]-3-methyloxetan-2-one (PubChem CID 50901909) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is (3R,4S)-4-[(2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-triethylsilyloxyhexan-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-triethylsilyloxyhexan-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 50901909 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (3R,4S)-4-[(2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-triethylsilyloxyhexan-2-yl]-3-methyloxetan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](COC)O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H]1OC(=O)[C@@H]1C |
| InChI | InChI=1S/C23H48O5Si2/c1-12-30(13-2,14-3)28-20(17(4)21-18(5)22(24)26-21)15-19(16-25-9)27-29(10,11)23(6,7)8/h17-21H,12-16H2,1-11H3/t17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | DPPOJOYNMSQOTQ-QSUVIHHLSA-N |
| XLogP | 6.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|