C17H26O7S — CID 10833240
methyl 6-[(2R)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropoxy]hexanoate (PubChem CID 10833240) has the molecular formula C17H26O7S and a molecular weight of 374.46 g/mol. Its IUPAC name is methyl 6-[(2R)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropoxy]hexanoate.
| Compound Name | methyl 6-[(2R)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropoxy]hexanoate |
|---|---|
| PubChem CID | 10833240 |
| Molecular Formula | C17H26O7S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 6-[(2R)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropoxy]hexanoate |
| SMILES | COC(=O)CCCCCOC[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H26O7S/c1-14-7-9-16(10-8-14)25(20,21)24-13-15(18)12-23-11-5-3-4-6-17(19)22-2/h7-10,15,18H,3-6,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | NXCLLMDSLUKHGR-OAHLLOKOSA-N |
| XLogP | 1.81 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|