C22H31NO7 — CID 10835957
N-[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-6-[[(2R)-oxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]hexanamide (PubChem CID 10835957) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-6-[[(2R)-oxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]hexanamide.
| Compound Name | N-[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-6-[[(2R)-oxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]hexanamide |
|---|---|
| PubChem CID | 10835957 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-6-[[(2R)-oxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@H]1[C@H](OC[C@H]2CO2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C22H31NO7/c1-2-3-5-10-17(24)23-18-19(25)20-16(29-22(18)27-12-15-11-26-15)13-28-21(30-20)14-8-6-4-7-9-14/h4,6-9,15-16,18-22,25H,2-3,5,10-13H2,1H3,(H,23,24)/t15-,16-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | KQTAHVKVCINOQQ-IXSVTQTNSA-N |
| XLogP | 1.67 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|