C28H25ClN4O6 — CID 10840375
N-[4-[[(4Z)-4-[(2-chlorophenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 10840375) has the molecular formula C28H25ClN4O6 and a molecular weight of 548.98 g/mol. Its IUPAC name is N-[4-[[(4Z)-4-[(2-chlorophenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-[[(4Z)-4-[(2-chlorophenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 10840375 |
| Molecular Formula | C28H25ClN4O6 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | N-[4-[[(4Z)-4-[(2-chlorophenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)NN3C(=O)/C(=C/c4ccccc4Cl)N=C3C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H25ClN4O6/c1-16-30-22(13-18-7-5-6-8-21(18)29)28(36)33(16)32-27(35)17-9-11-20(12-10-17)31-26(34)19-14-23(37-2)25(39-4)24(15-19)38-3/h5-15H,1-4H3,(H,31,34)(H,32,35)/b22-13- |
| InChIKey | DMHQEHIOZNPLJJ-XKZIYDEJSA-N |
| XLogP | 4.56 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|