C31H28N4O2S2 — CID 10840457
12-benzyl-6-methyl-8-(4-nitrophenyl)-4-phenylspiro[2,10-dithia-4,5,12-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclopentane] (PubChem CID 10840457) has the molecular formula C31H28N4O2S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is 12-benzyl-6-methyl-8-(4-nitrophenyl)-4-phenylspiro[2,10-dithia-4,5,12-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclopentane].
| Compound Name | 12-benzyl-6-methyl-8-(4-nitrophenyl)-4-phenylspiro[2,10-dithia-4,5,12-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclopentane] |
|---|---|
| PubChem CID | 10840457 |
| Molecular Formula | C31H28N4O2S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 12-benzyl-6-methyl-8-(4-nitrophenyl)-4-phenylspiro[2,10-dithia-4,5,12-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclopentane] |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccc([N+](=O)[O-])cc1)C1=C(S2)N(Cc2ccccc2)C2(CCCC2)S1 |
| InChI | InChI=1S/C31H28N4O2S2/c1-21-26-27(23-14-16-25(17-15-23)35(36)37)28-30(38-29(26)34(32-21)24-12-6-3-7-13-24)33(20-22-10-4-2-5-11-22)31(39-28)18-8-9-19-31/h2-7,10-17,27H,8-9,18-20H2,1H3 |
| InChIKey | SXFRVKTZVZKTLF-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|