C28H24N2O2S2 — CID 10390623
7-(4-nitrophenyl)-3,5-diphenylspiro[7H-thiopyrano[2,3-d][1,3]thiazole-2,1'-cyclopentane] (PubChem CID 10390623) has the molecular formula C28H24N2O2S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-3,5-diphenylspiro[7H-thiopyrano[2,3-d][1,3]thiazole-2,1'-cyclopentane].
| Compound Name | 7-(4-nitrophenyl)-3,5-diphenylspiro[7H-thiopyrano[2,3-d][1,3]thiazole-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 10390623 |
| Molecular Formula | C28H24N2O2S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 7-(4-nitrophenyl)-3,5-diphenylspiro[7H-thiopyrano[2,3-d][1,3]thiazole-2,1'-cyclopentane] |
| SMILES | O=[N+]([O-])c1ccc(C2C=C(c3ccccc3)SC3=C2SC2(CCCC2)N3c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O2S2/c31-30(32)23-15-13-20(14-16-23)24-19-25(21-9-3-1-4-10-21)33-27-26(24)34-28(17-7-8-18-28)29(27)22-11-5-2-6-12-22/h1-6,9-16,19,24H,7-8,17-18H2 |
| InChIKey | RUKULHSAWOQJSE-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|