C18H18N2O4S3 — CID 132934582
(4Z)-3-methylsulfonyl-2-(4-nitrophenyl)-5-phenyl-7,8-dihydro-2H-1,6,3-dithiazocine (PubChem CID 132934582) has the molecular formula C18H18N2O4S3 and a molecular weight of 422.55 g/mol. Its IUPAC name is (4Z)-3-methylsulfonyl-2-(4-nitrophenyl)-5-phenyl-7,8-dihydro-2H-1,6,3-dithiazocine.
| Compound Name | (4Z)-3-methylsulfonyl-2-(4-nitrophenyl)-5-phenyl-7,8-dihydro-2H-1,6,3-dithiazocine |
|---|---|
| PubChem CID | 132934582 |
| Molecular Formula | C18H18N2O4S3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (4Z)-3-methylsulfonyl-2-(4-nitrophenyl)-5-phenyl-7,8-dihydro-2H-1,6,3-dithiazocine |
| SMILES | CS(=O)(=O)N1/C=C(/c2ccccc2)SCCSC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O4S3/c1-27(23,24)19-13-17(14-5-3-2-4-6-14)25-11-12-26-18(19)15-7-9-16(10-8-15)20(21)22/h2-10,13,18H,11-12H2,1H3/b17-13- |
| InChIKey | GEQFFJRKWLYPCI-LGMDPLHJSA-N |
| XLogP | 4.33 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|