C32H32N4S — CID 135501137
12-benzyl-6-methyl-4,8-diphenylspiro[10-thia-2,4,5,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclohexane] (PubChem CID 135501137) has the molecular formula C32H32N4S and a molecular weight of 504.70 g/mol. Its IUPAC name is 12-benzyl-6-methyl-4,8-diphenylspiro[10-thia-2,4,5,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclohexane].
| Compound Name | 12-benzyl-6-methyl-4,8-diphenylspiro[10-thia-2,4,5,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclohexane] |
|---|---|
| PubChem CID | 135501137 |
| Molecular Formula | C32H32N4S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 12-benzyl-6-methyl-4,8-diphenylspiro[10-thia-2,4,5,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-triene-11,1'-cyclohexane] |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1)C1=C(N2)N(Cc2ccccc2)C2(CCCCC2)S1 |
| InChI | InChI=1S/C32H32N4S/c1-23-27-28(25-16-8-3-9-17-25)29-31(33-30(27)36(34-23)26-18-10-4-11-19-26)35(22-24-14-6-2-7-15-24)32(37-29)20-12-5-13-21-32/h2-4,6-11,14-19,28,33H,5,12-13,20-22H2,1H3 |
| InChIKey | BGGSZROSXYMNSE-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |