C18H31N4O12P2 — CID 10840536
CID 10840536 (PubChem CID 10840536) has the molecular formula C18H31N4O12P2 and a molecular weight of 557.41 g/mol.
| Compound Name | CID 10840536 |
|---|---|
| PubChem CID | 10840536 |
| Molecular Formula | C18H31N4O12P2 |
| Molecular Weight | 557.41 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]2O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C18H31N4O12P2/c1-17(2)7-10(8-18(3,4)22(17)26)33-36(29,30)34-35(27,28)31-9-11-13(23)14(24)15(32-11)21-6-5-12(19)20-16(21)25/h5-6,10-11,13-15,23-24H,7-9H2,1-4H3,(H,27,28)(H,29,30)(H2,19,20,25)/t11-,13-,14-,15-/m1/s1 |
| InChIKey | JMNHJRLNKXJCJF-NMFUWQPSSA-N |
| XLogP | 0.06 |
| TPSA | 236.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|