C33H44O6Si — CID 10840693
(2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanoic acid (PubChem CID 10840693) has the molecular formula C33H44O6Si and a molecular weight of 564.80 g/mol. Its IUPAC name is (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanoic acid.
| Compound Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanoic acid |
|---|---|
| PubChem CID | 10840693 |
| Molecular Formula | C33H44O6Si |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](COCc1ccccc1)C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H44O6Si/c1-33(2,3)40(4,5)39-29(25-36-22-26-15-9-6-10-16-26)21-30(37-23-27-17-11-7-12-18-27)31(32(34)35)38-24-28-19-13-8-14-20-28/h6-20,29-31H,21-25H2,1-5H3,(H,34,35)/t29-,30-,31+/m0/s1 |
| InChIKey | YUARLBDJNVFVJM-RWSKJCERSA-N |
| XLogP | 7.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|