C38H54O10Si — CID 10842423
[(1S,2S,3R,4S,7R,9S,10S,12R)-1,12-dihydroxy-10,14,17,17-tetramethyl-11,15-dioxo-4-pentanoyloxy-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 10842423) has the molecular formula C38H54O10Si and a molecular weight of 698.93 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,12R)-1,12-dihydroxy-10,14,17,17-tetramethyl-11,15-dioxo-4-pentanoyloxy-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,12R)-1,12-dihydroxy-10,14,17,17-tetramethyl-11,15-dioxo-4-pentanoyloxy-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 10842423 |
| Molecular Formula | C38H54O10Si |
| Molecular Weight | 698.93 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R)-1,12-dihydroxy-10,14,17,17-tetramethyl-11,15-dioxo-4-pentanoyloxy-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CCCCC(=O)O[C@@]12CO[C@@H]1C[C@H](O[Si](CC)(CC)CC)[C@@]1(C)C(=O)[C@H](O)C3=C(C)C(=O)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]21)C3(C)C |
| InChI | InChI=1S/C38H54O10Si/c1-9-13-19-28(40)47-37-22-45-27(37)20-26(48-49(10-2,11-3)12-4)36(8)31(37)33(46-34(43)24-17-15-14-16-18-24)38(44)21-25(39)23(5)29(35(38,6)7)30(41)32(36)42/h14-18,26-27,30-31,33,41,44H,9-13,19-22H2,1-8H3/t26-,27+,30+,31-,33-,36+,37-,38+/m0/s1 |
| InChIKey | WVZKWZGVQDRIIJ-MDEDISAXSA-N |
| XLogP | 5.49 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.93 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|