C8H8N2O2 — CID 10844750
(1S,6R)-3-prop-2-ynyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 10844750) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is (1S,6R)-3-prop-2-ynyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
| Compound Name | (1S,6R)-3-prop-2-ynyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
|---|---|
| PubChem CID | 10844750 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1S,6R)-3-prop-2-ynyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | C#CCN1NC(=O)[C@@H]2C[C@@H]2C1=O |
| InChI | InChI=1S/C8H8N2O2/c1-2-3-10-8(12)6-4-5(6)7(11)9-10/h1,5-6H,3-4H2,(H,9,11)/t5-,6+/m1/s1 |
| InChIKey | BQWVDCADPNKPJN-RITPCOANSA-N |
| XLogP | -0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|