C12H14OS — CID 10845967
2,5-dimethyl-4-phenylsulfanyl-2,3-dihydrofuran (PubChem CID 10845967) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenylsulfanyl-2,3-dihydrofuran.
| Compound Name | 2,5-dimethyl-4-phenylsulfanyl-2,3-dihydrofuran |
|---|---|
| PubChem CID | 10845967 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,5-dimethyl-4-phenylsulfanyl-2,3-dihydrofuran |
| SMILES | CC1=C(Sc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C12H14OS/c1-9-8-12(10(2)13-9)14-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | CLAFTWCNRHMGOF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |