About [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol
[(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol (PubChem CID 10847443) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol |
| PubChem CID | 10847443 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol |
| SMILES | CC(C)=C1CC/C(C)=C/CC[C@@]2(CO)O[C@H]2C1 |
| InChI | InChI=1S/C15H24O2/c1-11(2)13-7-6-12(3)5-4-8-15(10-16)14(9-13)17-15/h5,14,16H,4,6-10H2,1-3H3/b12-5+/t14-,15-/m0/s1 |
| InChIKey | MSHMJMYAOOCXCW-VNLLDLMDSA-N |
| XLogP | 3.36 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol?
The IUPAC name of [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol (CID 10847443) is [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol.
What is the SMILES notation for [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol?
The canonical SMILES for [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol is CC(C)=C1CC/C(C)=C/CC[C@@]2(CO)O[C@H]2C1.
What is the InChIKey of [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol?
The InChIKey is MSHMJMYAOOCXCW-VNLLDLMDSA-N. The full InChI is InChI=1S/C15H24O2/c1-11(2)13-7-6-12(3)5-4-8-15(10-16)14(9-13)17-15/h5,14,16H,4,6-10H2,1-3H3/b12-5+/t14-,15-/m0/s1.
What are the key properties of [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol?
[(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol has a molecular weight of 236.35 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4E,10S)-5-methyl-8-propan-2-ylidene-11-oxabicyclo[8.1.0]undec-4-en-1-yl]methanol is sourced from PubChem (CID 10847443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).