C21H32O5 — CID 162957229
(1S,3S,5R,15R,18R)-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one (PubChem CID 162957229) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (1S,3S,5R,15R,18R)-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one.
| Compound Name | (1S,3S,5R,15R,18R)-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
|---|---|
| PubChem CID | 162957229 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1S,3S,5R,15R,18R)-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
| SMILES | COC[C@@H]1C(=O)O[C@@H]2CC(C)=CCCC(C)=CCC[C@]3(CO)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C21H32O5/c1-14-6-4-7-15(2)10-18-16(17(12-24-3)20(23)25-18)11-19-21(13-22,26-19)9-5-8-14/h7-8,16-19,22H,4-6,9-13H2,1-3H3/t16-,17-,18+,19-,21+/m0/s1 |
| InChIKey | QKXORDKWURSOJS-ZFORQUDYSA-N |
| XLogP | 3.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|