C21H30O4 — CID 23258660
(3S,3aR,6E,10E,14E,15aR)-3-(methoxymethyl)-6,10,14-trimethyl-3,3a,4,5,8,12,13,15a-octahydrocyclotetradeca[b]furan-2,9-dione (PubChem CID 23258660) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3S,3aR,6E,10E,14E,15aR)-3-(methoxymethyl)-6,10,14-trimethyl-3,3a,4,5,8,12,13,15a-octahydrocyclotetradeca[b]furan-2,9-dione.
| Compound Name | (3S,3aR,6E,10E,14E,15aR)-3-(methoxymethyl)-6,10,14-trimethyl-3,3a,4,5,8,12,13,15a-octahydrocyclotetradeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 23258660 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3S,3aR,6E,10E,14E,15aR)-3-(methoxymethyl)-6,10,14-trimethyl-3,3a,4,5,8,12,13,15a-octahydrocyclotetradeca[b]furan-2,9-dione |
| SMILES | COC[C@H]1C(=O)O[C@H]2/C=C(\C)CC/C=C(\C)C(=O)C/C=C(\C)CC[C@@H]21 |
| InChI | InChI=1S/C21H30O4/c1-14-8-10-17-18(13-24-4)21(23)25-20(17)12-15(2)6-5-7-16(3)19(22)11-9-14/h7,9,12,17-18,20H,5-6,8,10-11,13H2,1-4H3/b14-9+,15-12+,16-7+/t17-,18-,20+/m1/s1 |
| InChIKey | FCUMVZZBLPMWHA-DIXBMPOXSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|