C24H37NO5 — CID 23427380
[(1S,3S,4S,7E,11E,13R,16S)-4-acetyl-16-(ethylaminomethyl)-7,11-dimethyl-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl] acetate (PubChem CID 23427380) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is [(1S,3S,4S,7E,11E,13R,16S)-4-acetyl-16-(ethylaminomethyl)-7,11-dimethyl-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl] acetate.
| Compound Name | [(1S,3S,4S,7E,11E,13R,16S)-4-acetyl-16-(ethylaminomethyl)-7,11-dimethyl-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl] acetate |
|---|---|
| PubChem CID | 23427380 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [(1S,3S,4S,7E,11E,13R,16S)-4-acetyl-16-(ethylaminomethyl)-7,11-dimethyl-15-oxo-14-oxabicyclo[11.3.0]hexadeca-7,11-dien-3-yl] acetate |
| SMILES | CCNC[C@H]1C(=O)O[C@H]2/C=C(\C)CC/C=C(\C)CC[C@H](C(C)=O)[C@@H](OC(C)=O)C[C@H]21 |
| InChI | InChI=1S/C24H37NO5/c1-6-25-14-21-20-13-23(29-18(5)27)19(17(4)26)11-10-15(2)8-7-9-16(3)12-22(20)30-24(21)28/h8,12,19-23,25H,6-7,9-11,13-14H2,1-5H3/b15-8+,16-12+/t19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | SHOIKWIJRWUSFP-YHPKHUIUSA-N |
| XLogP | 3.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|