C21H32O5 — CID 162900959
14-hydroxy-18-(methoxymethyl)-5,9,13-trimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one (PubChem CID 162900959) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 14-hydroxy-18-(methoxymethyl)-5,9,13-trimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one.
| Compound Name | 14-hydroxy-18-(methoxymethyl)-5,9,13-trimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
|---|---|
| PubChem CID | 162900959 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 14-hydroxy-18-(methoxymethyl)-5,9,13-trimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
| SMILES | COCC1C(=O)OC2C(O)C(C)=CCCC(C)=CCCC3(C)OC3CC12 |
| InChI | InChI=1S/C21H32O5/c1-13-7-5-9-14(2)18(22)19-15(16(12-24-4)20(23)25-19)11-17-21(3,26-17)10-6-8-13/h8-9,15-19,22H,5-7,10-12H2,1-4H3 |
| InChIKey | ZQXWIYRAINIQET-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|