C21H32O6 — CID 163192865
(1S,3S,5R,8E,12E,14S,15S,18S)-14-hydroxy-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one (PubChem CID 163192865) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (1S,3S,5R,8E,12E,14S,15S,18S)-14-hydroxy-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one.
| Compound Name | (1S,3S,5R,8E,12E,14S,15S,18S)-14-hydroxy-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
|---|---|
| PubChem CID | 163192865 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1S,3S,5R,8E,12E,14S,15S,18S)-14-hydroxy-5-(hydroxymethyl)-18-(methoxymethyl)-9,13-dimethyl-4,16-dioxatricyclo[13.3.0.03,5]octadeca-8,12-dien-17-one |
| SMILES | COC[C@H]1C(=O)O[C@H]2[C@H]1C[C@@H]1O[C@@]1(CO)CC/C=C(\C)CC/C=C(\C)[C@@H]2O |
| InChI | InChI=1S/C21H32O6/c1-13-6-4-8-14(2)18(23)19-15(16(11-25-3)20(24)26-19)10-17-21(12-22,27-17)9-5-7-13/h7-8,15-19,22-23H,4-6,9-12H2,1-3H3/b13-7+,14-8+/t15-,16+,17-,18-,19-,21+/m0/s1 |
| InChIKey | FPMLLSXHOPRAIM-XHTFXKOJSA-N |
| XLogP | 2.14 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|