C17H19N3O2 — CID 108500421
N'-(2-propan-2-ylphenyl)-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 108500421) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N'-(2-propan-2-ylphenyl)-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-(2-propan-2-ylphenyl)-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108500421 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N'-(2-propan-2-ylphenyl)-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CC(C)c1ccccc1NC(=O)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C17H19N3O2/c1-12(2)14-7-3-4-8-15(14)20-17(22)16(21)19-11-13-6-5-9-18-10-13/h3-10,12H,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DXRBQPBRJGKYMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|