C22H25ClN2O3 — CID 108501153
N-(3-chloro-4-methoxyphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide (PubChem CID 108501153) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 108501153 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
| SMILES | CCC(NC(=O)C(=O)Nc1ccc(OC)c(Cl)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H25ClN2O3/c1-3-19(16-9-8-14-6-4-5-7-15(14)12-16)25-22(27)21(26)24-17-10-11-20(28-2)18(23)13-17/h8-13,19H,3-7H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | COGIWGIUMVYILW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|