C22H22ClF3N2O2 — CID 108510709
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide (PubChem CID 108510709) has the molecular formula C22H22ClF3N2O2 and a molecular weight of 438.88 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 108510709 |
| Molecular Formula | C22H22ClF3N2O2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
| SMILES | CCC(NC(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H22ClF3N2O2/c1-2-19(15-8-7-13-5-3-4-6-14(13)11-15)28-21(30)20(29)27-16-9-10-18(23)17(12-16)22(24,25)26/h7-12,19H,2-6H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | KEBIXQNOIUKGIU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|