C27H38N2O2 — CID 108509001
N-[1-(1-adamantyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide (PubChem CID 108509001) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 108509001 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
| SMILES | CCC(NC(=O)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H38N2O2/c1-3-24(23-9-8-21-6-4-5-7-22(21)13-23)29-26(31)25(30)28-17(2)27-14-18-10-19(15-27)12-20(11-18)16-27/h8-9,13,17-20,24H,3-7,10-12,14-16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | ALFCMWYQJAVMDV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|