C11H10ClN5O2 — CID 108506085
N-[(2-chlorophenyl)methyl]-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108506085) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108506085 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | O=C(NCc1ccccc1Cl)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C11H10ClN5O2/c12-9-4-2-1-3-8(9)5-13-10(18)11(19)16-17-6-14-15-7-17/h1-4,6-7H,5H2,(H,13,18)(H,16,19) |
| InChIKey | FNJHKHBIQUPUGA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|