C14H28N4O4 — CID 108517898
2-[4-(2-aminoethyl)piperazin-1-yl]-N,N-bis(2-methoxyethyl)-2-oxoacetamide (PubChem CID 108517898) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)piperazin-1-yl]-N,N-bis(2-methoxyethyl)-2-oxoacetamide.
| Compound Name | 2-[4-(2-aminoethyl)piperazin-1-yl]-N,N-bis(2-methoxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108517898 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[4-(2-aminoethyl)piperazin-1-yl]-N,N-bis(2-methoxyethyl)-2-oxoacetamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C14H28N4O4/c1-21-11-9-18(10-12-22-2)14(20)13(19)17-7-5-16(4-3-15)6-8-17/h3-12,15H2,1-2H3 |
| InChIKey | GHSMJPPSUAKGKT-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|