C18H27N3O4S — CID 108518612
N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N-phenyloxamide (PubChem CID 108518612) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N-phenyloxamide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N-phenyloxamide |
|---|---|
| PubChem CID | 108518612 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N-phenyloxamide |
| SMILES | CCN(C(=O)C(=O)N(CCN(C)C)C1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C18H27N3O4S/c1-4-20(15-8-6-5-7-9-15)17(22)18(23)21(12-11-19(2)3)16-10-13-26(24,25)14-16/h5-9,16H,4,10-14H2,1-3H3 |
| InChIKey | BLGTYOZUFLMPFK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|