C12H19N3O2S — CID 108520614
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108520614) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108520614 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | CC1CC(C)CN(C(=O)C(=O)NC2=NCCS2)C1 |
| InChI | InChI=1S/C12H19N3O2S/c1-8-5-9(2)7-15(6-8)11(17)10(16)14-12-13-3-4-18-12/h8-9H,3-7H2,1-2H3,(H,13,14,16) |
| InChIKey | PGBFQLOOASDVCF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|