C11H16N4O3S — CID 108530780
1-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 108530780) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108530780 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)NC2=NCCS2)CC1 |
| InChI | InChI=1S/C11H16N4O3S/c12-8(16)7-1-4-15(5-2-7)10(18)9(17)14-11-13-3-6-19-11/h7H,1-6H2,(H2,12,16)(H,13,14,17) |
| InChIKey | RCCJQTHZBCPMSU-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|