C16H21N3O4 — CID 108503193
1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 108503193) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108503193 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)NCCc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C16H21N3O4/c17-14(21)12-6-9-19(10-7-12)16(23)15(22)18-8-5-11-1-3-13(20)4-2-11/h1-4,12,20H,5-10H2,(H2,17,21)(H,18,22) |
| InChIKey | WIPMDNBZHKRSAE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|