C15H27N3O4 — CID 108506628
1-[2-(3-butoxypropylamino)-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 108506628) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[2-(3-butoxypropylamino)-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3-butoxypropylamino)-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108506628 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-[2-(3-butoxypropylamino)-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | CCCCOCCCNC(=O)C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H27N3O4/c1-2-3-10-22-11-4-7-17-14(20)15(21)18-8-5-12(6-9-18)13(16)19/h12H,2-11H2,1H3,(H2,16,19)(H,17,20) |
| InChIKey | NLNWMDYDVUAVOI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|