C16H15F6N3O3 — CID 108530325
1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 108530325) has the molecular formula C16H15F6N3O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is 1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108530325 |
| Molecular Formula | C16H15F6N3O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H15F6N3O3/c17-15(18,19)9-5-10(16(20,21)22)7-11(6-9)24-13(27)14(28)25-3-1-8(2-4-25)12(23)26/h5-8H,1-4H2,(H2,23,26)(H,24,27) |
| InChIKey | FYNCNRRVGUAOCI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|