C14H15Cl2N3O2S — CID 17385988
1-[2-(3,5-dichloroanilino)-2-oxoethanethioyl]piperidine-4-carboxamide (PubChem CID 17385988) has the molecular formula C14H15Cl2N3O2S and a molecular weight of 360.27 g/mol. Its IUPAC name is 1-[2-(3,5-dichloroanilino)-2-oxoethanethioyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-dichloroanilino)-2-oxoethanethioyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17385988 |
| Molecular Formula | C14H15Cl2N3O2S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-[2-(3,5-dichloroanilino)-2-oxoethanethioyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=S)C(=O)Nc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H15Cl2N3O2S/c15-9-5-10(16)7-11(6-9)18-13(21)14(22)19-3-1-8(2-4-19)12(17)20/h5-8H,1-4H2,(H2,17,20)(H,18,21) |
| InChIKey | LWFNNRUVCFTRHM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|