C21H33N3O2 — CID 108522629
N'-(2-butan-2-ylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108522629) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N'-(2-butan-2-ylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(2-butan-2-ylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108522629 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N'-(2-butan-2-ylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CCC(C)c1ccccc1NC(=O)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H33N3O2/c1-7-14(2)16-10-8-9-11-17(16)23-19(26)18(25)22-15-12-20(3,4)24-21(5,6)13-15/h8-11,14-15,24H,7,12-13H2,1-6H3,(H,22,25)(H,23,26) |
| InChIKey | XNSNBMUDNGSGIO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|