C16H26N4O4S — CID 108522630
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-oxoacetamide (PubChem CID 108522630) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108522630 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-oxoacetamide |
| SMILES | CC1(C)CC(N)CC(C)(C)N1C(=O)C(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C16H26N4O4S/c1-15(2)7-10(17)8-16(3,4)20(15)13(23)12(22)18-5-6-19-11(21)9-25-14(19)24/h10H,5-9,17H2,1-4H3,(H,18,22) |
| InChIKey | VPKXCWUWARNAJI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|