C17H24O5 — CID 10852319
[(1S,4S,7R,10S,12R,13S,14R)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-5-en-12-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10852319) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(1S,4S,7R,10S,12R,13S,14R)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-5-en-12-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,4S,7R,10S,12R,13S,14R)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-5-en-12-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10852319 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1S,4S,7R,10S,12R,13S,14R)-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-5-en-12-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H]2OC[C@@H]3C=C[C@@H]4CO[C@H]1[C@@H]4[C@H]23 |
| InChI | InChI=1S/C17H24O5/c1-17(2,3)16(18)21-8-11-14-12-9(6-19-14)4-5-10-7-20-15(22-11)13(10)12/h4-5,9-15H,6-8H2,1-3H3/t9-,10+,11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | VFMALFNWIJRLDA-LJJRGKOZSA-N |
| XLogP | 1.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|