C15H19N3O5 — CID 108523927
N-(2,4-dimethoxyphenyl)-2-(4-formylpiperazin-1-yl)-2-oxoacetamide (PubChem CID 108523927) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(4-formylpiperazin-1-yl)-2-oxoacetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(4-formylpiperazin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108523927 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(4-formylpiperazin-1-yl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCN(C=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O5/c1-22-11-3-4-12(13(9-11)23-2)16-14(20)15(21)18-7-5-17(10-19)6-8-18/h3-4,9-10H,5-8H2,1-2H3,(H,16,20) |
| InChIKey | JYGZBPYCNFOUBB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|