C13H24N2O3 — CID 108524852
2-(2,6-dimethylpiperidin-1-yl)-N-ethyl-N-(2-hydroxyethyl)-2-oxoacetamide (PubChem CID 108524852) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-N-ethyl-N-(2-hydroxyethyl)-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-N-ethyl-N-(2-hydroxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108524852 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-N-ethyl-N-(2-hydroxyethyl)-2-oxoacetamide |
| SMILES | CCN(CCO)C(=O)C(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C13H24N2O3/c1-4-14(8-9-16)12(17)13(18)15-10(2)6-5-7-11(15)3/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | IRGHCOQGNHGRCB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|