C14H28N2O3 — CID 108525272
N'-tert-butyl-N'-ethyl-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 108525272) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-tert-butyl-N'-ethyl-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-tert-butyl-N'-ethyl-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 108525272 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N'-tert-butyl-N'-ethyl-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CCN(C(=O)C(=O)NCCCOC(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-7-16(14(4,5)6)13(18)12(17)15-9-8-10-19-11(2)3/h11H,7-10H2,1-6H3,(H,15,17) |
| InChIKey | AUFUFLUCLJMBSN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|