C15H30N3O3+ — CID 11897657
N'-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 11897657) has the molecular formula C15H30N3O3+ and a molecular weight of 300.42 g/mol. Its IUPAC name is N'-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 11897657 |
| Molecular Formula | C15H30N3O3+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N'-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CC[NH+]1CCC[C@H]1CNC(=O)C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C15H29N3O3/c1-4-18-9-5-7-13(18)11-17-15(20)14(19)16-8-6-10-21-12(2)3/h12-13H,4-11H2,1-3H3,(H,16,19)(H,17,20)/p+1/t13-/m0/s1 |
| InChIKey | SOTDZFYTDCLVST-ZDUSSCGKSA-O |
| XLogP | -0.90 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|