C15H20O7 — CID 10852562
1-O-ethyl 6-O,7-O-dimethyl (1S,5R)-5-methyl-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate (PubChem CID 10852562) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-O-ethyl 6-O,7-O-dimethyl (1S,5R)-5-methyl-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate.
| Compound Name | 1-O-ethyl 6-O,7-O-dimethyl (1S,5R)-5-methyl-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate |
|---|---|
| PubChem CID | 10852562 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-O-ethyl 6-O,7-O-dimethyl (1S,5R)-5-methyl-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@@](C)(O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C15H20O7/c1-5-21-13(18)15-8-6-7-14(2,22-15)9(11(16)19-3)10(15)12(17)20-4/h5-8H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | IWSFTWSLNRXCLS-CABCVRRESA-N |
| XLogP | 0.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|