C20H22ClN3O4 — CID 108527534
N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-ylphenyl)oxamide (PubChem CID 108527534) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-ylphenyl)oxamide.
| Compound Name | N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108527534 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-ylphenyl)oxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-13-11-16(18(27-2)12-14(13)21)23-20(26)19(25)22-15-5-3-4-6-17(15)24-7-9-28-10-8-24/h3-6,11-12H,7-10H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | GXDRCAKMGLOMRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|