C17H21N3O3 — CID 10852827
3-(3,4-dimethoxyphenyl)-4-piperidin-1-yl-1H-pyridazin-6-one (PubChem CID 10852827) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-piperidin-1-yl-1H-pyridazin-6-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-piperidin-1-yl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 10852827 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-piperidin-1-yl-1H-pyridazin-6-one |
| SMILES | COc1ccc(-c2n[nH]c(=O)cc2N2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H21N3O3/c1-22-14-7-6-12(10-15(14)23-2)17-13(11-16(21)18-19-17)20-8-4-3-5-9-20/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,18,21) |
| InChIKey | YRIMRFISHSDFJR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |