C19H22ClNO2 — CID 10853999
(1R,2R,5S,7S,10R,11S)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradecan-4-one (PubChem CID 10853999) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is (1R,2R,5S,7S,10R,11S)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradecan-4-one.
| Compound Name | (1R,2R,5S,7S,10R,11S)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradecan-4-one |
|---|---|
| PubChem CID | 10853999 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (1R,2R,5S,7S,10R,11S)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradecan-4-one |
| SMILES | C[C@H]1C[C@@]2(c3ccc(Cl)cc3)OC[C@@H]3[C@H]4CC[C@H](C4)[C@H]3N2C1=O |
| InChI | InChI=1S/C19H22ClNO2/c1-11-9-19(14-4-6-15(20)7-5-14)21(18(11)22)17-13-3-2-12(8-13)16(17)10-23-19/h4-7,11-13,16-17H,2-3,8-10H2,1H3/t11-,12-,13+,16+,17+,19-/m0/s1 |
| InChIKey | WKMLWONEIUILPG-RFGISZLVSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |