C23H20Cl3NO2 — CID 638849
(1S,2R,6R,9S,10R,11R)-5,5-dichloro-6-(4-chlorophenyl)-11-phenyl-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridecan-4-one (PubChem CID 638849) has the molecular formula C23H20Cl3NO2 and a molecular weight of 448.78 g/mol. Its IUPAC name is (1S,2R,6R,9S,10R,11R)-5,5-dichloro-6-(4-chlorophenyl)-11-phenyl-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridecan-4-one.
| Compound Name | (1S,2R,6R,9S,10R,11R)-5,5-dichloro-6-(4-chlorophenyl)-11-phenyl-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridecan-4-one |
|---|---|
| PubChem CID | 638849 |
| Molecular Formula | C23H20Cl3NO2 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (1S,2R,6R,9S,10R,11R)-5,5-dichloro-6-(4-chlorophenyl)-11-phenyl-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridecan-4-one |
| SMILES | O=C1N2[C@@H]3[C@H]4C[C@@H]([C@@H]3CO[C@]2(c2ccc(Cl)cc2)C1(Cl)Cl)[C@H](c1ccccc1)C4 |
| InChI | InChI=1S/C23H20Cl3NO2/c24-16-8-6-15(7-9-16)23-22(25,26)21(28)27(23)20-14-10-17(13-4-2-1-3-5-13)18(11-14)19(20)12-29-23/h1-9,14,17-20H,10-12H2/t14-,17+,18-,19+,20-,23-/m1/s1 |
| InChIKey | LTFAGVAMPHMPPG-IRSSTRAHSA-N |
| XLogP | 5.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|