C28H30ClNO2 — CID 22298041
(1S,2R,14S,15R,16R)-11-(4-chlorophenyl)-16-phenyl-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadecan-4-one (PubChem CID 22298041) has the molecular formula C28H30ClNO2 and a molecular weight of 448.01 g/mol. Its IUPAC name is (1S,2R,14S,15R,16R)-11-(4-chlorophenyl)-16-phenyl-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadecan-4-one.
| Compound Name | (1S,2R,14S,15R,16R)-11-(4-chlorophenyl)-16-phenyl-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadecan-4-one |
|---|---|
| PubChem CID | 22298041 |
| Molecular Formula | C28H30ClNO2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (1S,2R,14S,15R,16R)-11-(4-chlorophenyl)-16-phenyl-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadecan-4-one |
| SMILES | O=C1C2CCCCC2C2(c3ccc(Cl)cc3)OC[C@H]3[C@@H]4C[C@@H](C[C@H]4c4ccccc4)[C@H]3N12 |
| InChI | InChI=1S/C28H30ClNO2/c29-20-12-10-19(11-13-20)28-25-9-5-4-8-21(25)27(31)30(28)26-18-14-22(17-6-2-1-3-7-17)23(15-18)24(26)16-32-28/h1-3,6-7,10-13,18,21-26H,4-5,8-9,14-16H2/t18-,21?,22+,23-,24+,25?,26-,28?/m1/s1 |
| InChIKey | DNLUGVKQXSLWEW-WVKSOKOGSA-N |
| XLogP | 5.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |