C17H14Cl3NO2 — CID 13460994
(1S,2R,6R,9S,10R)-5,5-dichloro-6-(4-chlorophenyl)-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridec-11-en-4-one (PubChem CID 13460994) has the molecular formula C17H14Cl3NO2 and a molecular weight of 370.66 g/mol. Its IUPAC name is (1S,2R,6R,9S,10R)-5,5-dichloro-6-(4-chlorophenyl)-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridec-11-en-4-one.
| Compound Name | (1S,2R,6R,9S,10R)-5,5-dichloro-6-(4-chlorophenyl)-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridec-11-en-4-one |
|---|---|
| PubChem CID | 13460994 |
| Molecular Formula | C17H14Cl3NO2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | (1S,2R,6R,9S,10R)-5,5-dichloro-6-(4-chlorophenyl)-7-oxa-3-azatetracyclo[8.2.1.02,9.03,6]tridec-11-en-4-one |
| SMILES | O=C1N2[C@H]3[C@@H](CO[C@]2(c2ccc(Cl)cc2)C1(Cl)Cl)[C@H]1C=C[C@@H]3C1 |
| InChI | InChI=1S/C17H14Cl3NO2/c18-12-5-3-11(4-6-12)17-16(19,20)15(22)21(17)14-10-2-1-9(7-10)13(14)8-23-17/h1-6,9-10,13-14H,7-8H2/t9-,10+,13-,14+,17+/m0/s1 |
| InChIKey | RGAAMKATBKPRIH-GVVOETNBSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|