C15H12N2O3S2 — CID 10854032
2-(benzenesulfonyl)-5-(4-methoxyphenyl)-1,3,4-thiadiazole (PubChem CID 10854032) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-(4-methoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(benzenesulfonyl)-5-(4-methoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 10854032 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-(benzenesulfonyl)-5-(4-methoxyphenyl)-1,3,4-thiadiazole |
| SMILES | COc1ccc(-c2nnc(S(=O)(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C15H12N2O3S2/c1-20-12-9-7-11(8-10-12)14-16-17-15(21-14)22(18,19)13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | MTRMXBSZTPFDLH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |