C23H30N4O5 — CID 108540987
1-tert-butyl-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 108540987) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-tert-butyl-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108540987 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-tert-butyl-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)N1CC(C(=O)NCCNC(=O)CCCN2C(=O)c3ccccc3C2=O)CC1=O |
| InChI | InChI=1S/C23H30N4O5/c1-23(2,3)27-14-15(13-19(27)29)20(30)25-11-10-24-18(28)9-6-12-26-21(31)16-7-4-5-8-17(16)22(26)32/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,24,28)(H,25,30) |
| InChIKey | OQEYRKHZNBGBOH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|